C14H12Cl2N2O6S — CID 46426066
[1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 46426066) has the molecular formula C14H12Cl2N2O6S and a molecular weight of 407.23 g/mol. Its IUPAC name is [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 46426066 |
| Molecular Formula | C14H12Cl2N2O6S |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | [1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl2N2O6S/c1-7(13(19)18-9-4-2-3-8(15)12(9)16)23-14(20)10-5-6-11(24-10)25(17,21)22/h2-7H,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | SAFFKZQXMIVKNZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |