C15H19N3O6S — CID 55643970
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55643970) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55643970 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C15H19N3O6S/c1-10(13(19)18-15(9-16)7-3-2-4-8-15)23-14(20)11-5-6-12(24-11)25(17,21)22/h5-6,10H,2-4,7-8H2,1H3,(H,18,19)(H2,17,21,22) |
| InChIKey | UWZSHRFERUAUFF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 152.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |