C15H18N2O4 — CID 7814385
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 7814385) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7814385 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccco1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C15H18N2O4/c1-11(21-14(19)12-6-5-9-20-12)13(18)17-15(10-16)7-3-2-4-8-15/h5-6,9,11H,2-4,7-8H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | LZQMMYNOHYAGJH-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |