C16H20N2O3S — CID 7837951
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-methylthiophene-2-carboxylate (PubChem CID 7837951) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-methylthiophene-2-carboxylate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7837951 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)NC2(C#N)CCCCC2)s1 |
| InChI | InChI=1S/C16H20N2O3S/c1-11-6-7-13(22-11)15(20)21-12(2)14(19)18-16(10-17)8-4-3-5-9-16/h6-7,12H,3-5,8-9H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | RCNVDUPKGNLPFF-LBPRGKRZSA-N |
| XLogP | 2.94 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |