C21H25N3O3 — CID 24981742
[1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 24981742) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 24981742 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OC(C)C(=O)NC3(C#N)CCCCC3)cc2c1C |
| InChI | InChI=1S/C21H25N3O3/c1-13-14(2)23-18-8-7-16(11-17(13)18)20(26)27-15(3)19(25)24-21(12-22)9-5-4-6-10-21/h7-8,11,15,23H,4-6,9-10H2,1-3H3,(H,24,25) |
| InChIKey | UELCVGRXWOHXNR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|