C14H18N2O2 — CID 54904517
N-(1-cyanocyclooctyl)furan-2-carboxamide (PubChem CID 54904517) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(1-cyanocyclooctyl)furan-2-carboxamide.
| Compound Name | N-(1-cyanocyclooctyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 54904517 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-(1-cyanocyclooctyl)furan-2-carboxamide |
| SMILES | N#CC1(NC(=O)c2ccco2)CCCCCCC1 |
| InChI | InChI=1S/C14H18N2O2/c15-11-14(8-4-2-1-3-5-9-14)16-13(17)12-7-6-10-18-12/h6-7,10H,1-5,8-9H2,(H,16,17) |
| InChIKey | HZDWEKAPJLDNQA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |