C18H22N2O5S — CID 7725085
[(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-methylsulfonylbenzoate (PubChem CID 7725085) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-methylsulfonylbenzoate.
| Compound Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725085 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-methylsulfonylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1S(C)(=O)=O)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C18H22N2O5S/c1-13(16(21)20-18(12-19)10-6-3-7-11-18)25-17(22)14-8-4-5-9-15(14)26(2,23)24/h4-5,8-9,13H,3,6-7,10-11H2,1-2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | WDTVHZXPLPXTAJ-CYBMUJFWSA-N |
| XLogP | 1.98 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |