C19H24N2O5S — CID 8857605
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate (PubChem CID 8857605) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8857605 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)O[C@@H](C)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C19H24N2O5S/c1-3-27(24,25)16-10-6-5-9-15(16)18(23)26-14(2)17(22)21-19(13-20)11-7-4-8-12-19/h5-6,9-10,14H,3-4,7-8,11-12H2,1-2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | BMIJYRDZGZTLEI-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |