C20H26N2O5S — CID 9307902
[(2R)-1-[(1-cyanocyclohexyl)-methylamino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate (PubChem CID 9307902) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is [(2R)-1-[(1-cyanocyclohexyl)-methylamino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate.
| Compound Name | [(2R)-1-[(1-cyanocyclohexyl)-methylamino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 9307902 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [(2R)-1-[(1-cyanocyclohexyl)-methylamino]-1-oxopropan-2-yl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)O[C@H](C)C(=O)N(C)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C20H26N2O5S/c1-4-28(25,26)17-11-7-6-10-16(17)19(24)27-15(2)18(23)22(3)20(14-21)12-8-5-9-13-20/h6-7,10-11,15H,4-5,8-9,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | OFFYSDDFXBJGLO-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |