C21H22N2O4 — CID 7812266
[(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7812266) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7812266 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [(2S)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2ccccc2cc1O)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C21H22N2O4/c1-14(19(25)23-21(13-22)9-5-2-6-10-21)27-20(26)17-11-15-7-3-4-8-16(15)12-18(17)24/h3-4,7-8,11-12,14,24H,2,5-6,9-10H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | GKPWAOVXFSORLC-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |