C17H17ClF2N2O3 — CID 8753130
[(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 8753130) has the molecular formula C17H17ClF2N2O3 and a molecular weight of 370.78 g/mol. Its IUPAC name is [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 8753130 |
| Molecular Formula | C17H17ClF2N2O3 |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [(2R)-1-[(1-cyanocyclohexyl)amino]-1-oxopropan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)c(F)cc1Cl)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H17ClF2N2O3/c1-10(15(23)22-17(9-21)5-3-2-4-6-17)25-16(24)11-7-13(19)14(20)8-12(11)18/h7-8,10H,2-6H2,1H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | IKLVEEXPANOSBS-SNVBAGLBSA-N |
| XLogP | 3.51 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|