C14H12ClN3O8S — CID 55644143
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55644143) has the molecular formula C14H12ClN3O8S and a molecular weight of 417.78 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55644143 |
| Molecular Formula | C14H12ClN3O8S |
| Molecular Weight | 417.78 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(S(N)(=O)=O)o1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H12ClN3O8S/c1-7(25-14(20)11-4-5-12(26-11)27(16,23)24)13(19)17-10-3-2-8(18(21)22)6-9(10)15/h2-7H,1H3,(H,17,19)(H2,16,23,24) |
| InChIKey | SWALOFBAOUKOHM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|