C21H22ClN3O6 — CID 32975939
[(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ylmethyl)benzoate (PubChem CID 32975939) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 32975939 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [(2S)-1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ylmethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(CN2CCOCC2)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C21H22ClN3O6/c1-14(20(26)23-19-7-6-17(25(28)29)12-18(19)22)31-21(27)16-4-2-15(3-5-16)13-24-8-10-30-11-9-24/h2-7,12,14H,8-11,13H2,1H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | IPGMRNFDBNHGFM-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|