C24H18ClN3O5S2 — CID 16958607
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 16958607) has the molecular formula C24H18ClN3O5S2 and a molecular weight of 528.01 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 16958607 |
| Molecular Formula | C24H18ClN3O5S2 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(CSc2nc3ccccc3s2)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C24H18ClN3O5S2/c1-14(22(29)26-19-11-10-17(28(31)32)12-18(19)25)33-23(30)16-8-6-15(7-9-16)13-34-24-27-20-4-2-3-5-21(20)35-24/h2-12,14H,13H2,1H3,(H,26,29) |
| InChIKey | RFOKKLPOLXDYSS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|