C21H20N2O7S — CID 55644172
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 5-sulfamoylfuran-2-carboxylate (PubChem CID 55644172) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 5-sulfamoylfuran-2-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 5-sulfamoylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55644172 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 5-sulfamoylfuran-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)c1ccc(S(N)(=O)=O)o1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O7S/c1-2-28-16-11-7-6-10-15(16)23-20(24)19(14-8-4-3-5-9-14)30-21(25)17-12-13-18(29-17)31(22,26)27/h3-13,19H,2H2,1H3,(H,23,24)(H2,22,26,27) |
| InChIKey | PBBYDVRYRQFGNP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |