C25H25NO6S — CID 42981819
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 42981819) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 42981819 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)c1cc(S(C)(=O)=O)ccc1C)c1ccccc1 |
| InChI | InChI=1S/C25H25NO6S/c1-4-31-22-13-9-8-12-21(22)26-24(27)23(18-10-6-5-7-11-18)32-25(28)20-16-19(33(3,29)30)15-14-17(20)2/h5-16,23H,4H2,1-3H3,(H,26,27) |
| InChIKey | ZBPYPAJPHBQICL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |