C23H20Cl2N2O4 — CID 16568840
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 16568840) has the molecular formula C23H20Cl2N2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 16568840 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)c1cc(Cl)cc(Cl)c1N)c1ccccc1 |
| InChI | InChI=1S/C23H20Cl2N2O4/c1-2-30-19-11-7-6-10-18(19)27-22(28)21(14-8-4-3-5-9-14)31-23(29)16-12-15(24)13-17(25)20(16)26/h3-13,21H,2,26H2,1H3,(H,27,28) |
| InChIKey | OCTQFKAIDHPONK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|