C24H22ClNO4 — CID 2092525
[(1R)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(4-chlorophenyl)acetate (PubChem CID 2092525) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is [(1R)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(4-chlorophenyl)acetate.
| Compound Name | [(1R)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 2092525 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | [(1R)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(4-chlorophenyl)acetate |
| SMILES | CCOc1ccccc1NC(=O)[C@H](OC(=O)Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22ClNO4/c1-2-29-21-11-7-6-10-20(21)26-24(28)23(18-8-4-3-5-9-18)30-22(27)16-17-12-14-19(25)15-13-17/h3-15,23H,2,16H2,1H3,(H,26,28)/t23-/m1/s1 |
| InChIKey | RDBXZSZJPBRJQS-HSZRJFAPSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |