C21H19NO5 — CID 55318659
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate (PubChem CID 55318659) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 55318659 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] furan-2-carboxylate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO5/c1-2-25-17-12-7-6-11-16(17)22-20(23)19(15-9-4-3-5-10-15)27-21(24)18-13-8-14-26-18/h3-14,19H,2H2,1H3,(H,22,23) |
| InChIKey | YHQKILBAFSLXAP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |