C27H29NO5 — CID 3259841
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-butoxybenzoate (PubChem CID 3259841) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-butoxybenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 3259841 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OC(C(=O)Nc2ccccc2OCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-3-5-19-32-22-17-15-21(16-18-22)27(30)33-25(20-11-7-6-8-12-20)26(29)28-23-13-9-10-14-24(23)31-4-2/h6-18,25H,3-5,19H2,1-2H3,(H,28,29) |
| InChIKey | AITWSBYFRIMUQY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|