C24H21NO5 — CID 2504162
[(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-formylbenzoate (PubChem CID 2504162) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-formylbenzoate.
| Compound Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504162 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(1S)-2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 4-formylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](OC(=O)c1ccc(C=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO5/c1-2-29-21-11-7-6-10-20(21)25-23(27)22(18-8-4-3-5-9-18)30-24(28)19-14-12-17(16-26)13-15-19/h3-16,22H,2H2,1H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | PBGRFNSOHGWHSL-QFIPXVFZSA-N |
| XLogP | 4.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|