C29H26N2O6 — CID 16534264
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 16534264) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 16534264 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O6/c1-3-35-24-13-8-7-12-22(24)30-28(33)26(20-10-5-4-6-11-20)37-29(34)21-16-15-19(2)23(18-21)31-27(32)25-14-9-17-36-25/h4-18,26H,3H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | IJOQRQZTAGAXTE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |