C23H22N2O6 — CID 46791499
[2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 46791499) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 46791499 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxo-1-phenylethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | CCOc1ccccc1NC(=O)C(OC(=O)CNC(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O6/c1-2-29-18-12-7-6-11-17(18)25-23(28)21(16-9-4-3-5-10-16)31-20(26)15-24-22(27)19-13-8-14-30-19/h3-14,21H,2,15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | QYQACEOHUUNQQN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |