C28H20N2O7 — CID 55373850
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 55373850) has the molecular formula C28H20N2O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 55373850 |
| Molecular Formula | C28H20N2O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2C(=O)CCC2=O)cc1)C(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H20N2O7/c1-15(37-28(36)16-9-11-17(12-10-16)30-22(31)13-14-23(30)32)27(35)29-21-8-4-7-20-24(21)26(34)19-6-3-2-5-18(19)25(20)33/h2-12,15H,13-14H2,1H3,(H,29,35) |
| InChIKey | CDLOUGHBKUKVLP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|