C28H22N4O5 — CID 55644643
[1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55644643) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
| Compound Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55644643 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-1-yl)amino]-1-oxopropan-2-yl] 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)OC(C)C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)cn2)n1 |
| InChI | InChI=1S/C28H22N4O5/c1-15-13-16(2)32(31-15)23-12-11-18(14-29-23)28(36)37-17(3)27(35)30-22-10-6-9-21-24(22)26(34)20-8-5-4-7-19(20)25(21)33/h4-14,17H,1-3H3,(H,30,35) |
| InChIKey | CHKBQNPMPPWRLQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|