propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate

C14H17N3O2 — CID 55644847

IUPACpropan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate
SMILESCc1cc(C)n(-c2ccc(C(=O)OC(C)C)cn2)n1
InChIInChI=1S/C14H17N3O2/c1-9(2)19-14(18)12-5-6-13(15-8-12)17-11(4)7-10(3)16-17/h5-9H,1-4H3
InChIKeyZXDOTGSFTKIASA-UHFFFAOYSA-N
MW259.31 g/mol
LogP2.45
Rot. Bonds3

About propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate

propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55644847) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.

Molecular Properties

Compound Namepropan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate
PubChem CID55644847
Molecular FormulaC14H17N3O2
Molecular Weight259.31 g/mol
Exact Mass259.13
IUPAC Namepropan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate
SMILESCc1cc(C)n(-c2ccc(C(=O)OC(C)C)cn2)n1
InChIInChI=1S/C14H17N3O2/c1-9(2)19-14(18)12-5-6-13(15-8-12)17-11(4)7-10(3)16-17/h5-9H,1-4H3
InChIKeyZXDOTGSFTKIASA-UHFFFAOYSA-N
XLogP2.45
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The IUPAC name of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (CID 55644847) is propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The canonical SMILES for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate is Cc1cc(C)n(-c2ccc(C(=O)OC(C)C)cn2)n1.
What is the InChIKey of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The InChIKey is ZXDOTGSFTKIASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-9(2)19-14(18)12-5-6-13(15-8-12)17-11(4)7-10(3)16-17/h5-9H,1-4H3.
What are the key properties of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate has a molecular weight of 259.31 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 55644847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).