About propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate
propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55644847) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
Analyze propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The IUPAC name of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (CID 55644847) is propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The canonical SMILES for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate is Cc1cc(C)n(-c2ccc(C(=O)OC(C)C)cn2)n1.
What is the InChIKey of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
The InChIKey is ZXDOTGSFTKIASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-9(2)19-14(18)12-5-6-13(15-8-12)17-11(4)7-10(3)16-17/h5-9H,1-4H3.
What are the key properties of propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate?
propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate has a molecular weight of 259.31 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 55644847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).