C15H19N3O2 — CID 55703799
butyl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate (PubChem CID 55703799) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is butyl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate.
| Compound Name | butyl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55703799 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | butyl 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(-n2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-5-8-20-15(19)13-6-7-14(16-10-13)18-12(3)9-11(2)17-18/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | KCSWODDVVNCNRY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|