C15H16N4O5S — CID 55568521
[1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 4-methyl-3-sulfamoylbenzoate (PubChem CID 55568521) has the molecular formula C15H16N4O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 4-methyl-3-sulfamoylbenzoate.
| Compound Name | [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 4-methyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55568521 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [1-oxo-1-(pyrimidin-2-ylamino)propan-2-yl] 4-methyl-3-sulfamoylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)Nc2ncccn2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H16N4O5S/c1-9-4-5-11(8-12(9)25(16,22)23)14(21)24-10(2)13(20)19-15-17-6-3-7-18-15/h3-8,10H,1-2H3,(H2,16,22,23)(H,17,18,19,20) |
| InChIKey | QQNWFCAIIFYYMD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |