C24H24N2O6S — CID 46812224
[1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3,4-dimethyl-5-sulfamoylbenzoate (PubChem CID 46812224) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3,4-dimethyl-5-sulfamoylbenzoate.
| Compound Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3,4-dimethyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46812224 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [1-oxo-1-(4-phenoxyanilino)propan-2-yl] 3,4-dimethyl-5-sulfamoylbenzoate |
| SMILES | Cc1cc(C(=O)OC(C)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C24H24N2O6S/c1-15-13-18(14-22(16(15)2)33(25,29)30)24(28)31-17(3)23(27)26-19-9-11-21(12-10-19)32-20-7-5-4-6-8-20/h4-14,17H,1-3H3,(H,26,27)(H2,25,29,30) |
| InChIKey | GDJUNSYYZWNZGZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |