About quinolin-2-amine;zirconium
quinolin-2-amine;zirconium (PubChem CID 175251209) has the molecular formula C9H8N2Zr
and a molecular weight of 235.40 g/mol. Its IUPAC name is quinolin-2-amine;zirconium.
Molecular Properties
| Compound Name | quinolin-2-amine;zirconium |
| PubChem CID | 175251209 |
| Molecular Formula | C9H8N2Zr |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 233.97 |
| IUPAC Name | quinolin-2-amine;zirconium |
| SMILES | Nc1ccc2ccccc2n1.[Zr] |
| InChI | InChI=1S/C9H8N2.Zr/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H2,10,11); |
| InChIKey | MRXJSJNHTGLKSB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-2-amine;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-amine;zirconium?
The IUPAC name of quinolin-2-amine;zirconium (CID 175251209) is quinolin-2-amine;zirconium.
What is the SMILES notation for quinolin-2-amine;zirconium?
The canonical SMILES for quinolin-2-amine;zirconium is Nc1ccc2ccccc2n1.[Zr].
What is the InChIKey of quinolin-2-amine;zirconium?
The InChIKey is MRXJSJNHTGLKSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.Zr/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H,(H2,10,11);.
What are the key properties of quinolin-2-amine;zirconium?
quinolin-2-amine;zirconium has a molecular weight of 235.40 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-amine;zirconium is sourced from PubChem (CID 175251209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).