About quinolin-2-ylmethanamine;dihydrochloride
quinolin-2-ylmethanamine;dihydrochloride (PubChem CID 18507294) has the molecular formula C10H12Cl2N2
and a molecular weight of 231.13 g/mol. Its IUPAC name is quinolin-2-ylmethanamine;dihydrochloride.
Molecular Properties
| Compound Name | quinolin-2-ylmethanamine;dihydrochloride |
| PubChem CID | 18507294 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | quinolin-2-ylmethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H10N2.2ClH/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;;/h1-6H,7,11H2;2*1H |
| InChIKey | XPAZBFLKFMBGMF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-2-ylmethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-ylmethanamine;dihydrochloride?
The IUPAC name of quinolin-2-ylmethanamine;dihydrochloride (CID 18507294) is quinolin-2-ylmethanamine;dihydrochloride.
What is the SMILES notation for quinolin-2-ylmethanamine;dihydrochloride?
The canonical SMILES for quinolin-2-ylmethanamine;dihydrochloride is Cl.Cl.NCc1ccc2ccccc2n1.
What is the InChIKey of quinolin-2-ylmethanamine;dihydrochloride?
The InChIKey is XPAZBFLKFMBGMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.2ClH/c11-7-9-6-5-8-3-1-2-4-10(8)12-9;;/h1-6H,7,11H2;2*1H.
What are the key properties of quinolin-2-ylmethanamine;dihydrochloride?
quinolin-2-ylmethanamine;dihydrochloride has a molecular weight of 231.13 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-ylmethanamine;dihydrochloride is sourced from PubChem (CID 18507294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).