About 2-(iodomethyl)quinoline
2-(iodomethyl)quinoline (PubChem CID 19432604) has the molecular formula C10H8IN
and a molecular weight of 269.09 g/mol. Its IUPAC name is 2-(iodomethyl)quinoline.
Molecular Properties
| Compound Name | 2-(iodomethyl)quinoline |
| PubChem CID | 19432604 |
| Molecular Formula | C10H8IN |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2-(iodomethyl)quinoline |
| SMILES | ICc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H8IN/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7H2 |
| InChIKey | IAWDIURGJOQRIE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)quinoline?
The IUPAC name of 2-(iodomethyl)quinoline (CID 19432604) is 2-(iodomethyl)quinoline.
What is the SMILES notation for 2-(iodomethyl)quinoline?
The canonical SMILES for 2-(iodomethyl)quinoline is ICc1ccc2ccccc2n1.
What is the InChIKey of 2-(iodomethyl)quinoline?
The InChIKey is IAWDIURGJOQRIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8IN/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H,7H2.
What are the key properties of 2-(iodomethyl)quinoline?
2-(iodomethyl)quinoline has a molecular weight of 269.09 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)quinoline is sourced from PubChem (CID 19432604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).