C9H9N3 — CID 22018948
quinoline-2,6-diamine (PubChem CID 22018948) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is quinoline-2,6-diamine.
| Compound Name | quinoline-2,6-diamine |
|---|---|
| PubChem CID | 22018948 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(N)ccc2c1 |
| InChI | InChI=1S/C9H9N3/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H,10H2,(H2,11,12) |
| InChIKey | WECFWBJFIOOXPR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|