C14H23N3O — CID 143375895
methanol;2-methylpropane;quinoline-2,6-diamine (PubChem CID 143375895) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is methanol;2-methylpropane;quinoline-2,6-diamine.
| Compound Name | methanol;2-methylpropane;quinoline-2,6-diamine |
|---|---|
| PubChem CID | 143375895 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | methanol;2-methylpropane;quinoline-2,6-diamine |
| SMILES | CC(C)C.CO.Nc1ccc2nc(N)ccc2c1 |
| InChI | InChI=1S/C9H9N3.C4H10.CH4O/c10-7-2-3-8-6(5-7)1-4-9(11)12-8;1-4(2)3;1-2/h1-5H,10H2,(H2,11,12);4H,1-3H3;2H,1H3 |
| InChIKey | QCYYMPPPNNIPJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|