About quinoline-2-carbaldehyde;hydrate
quinoline-2-carbaldehyde;hydrate (PubChem CID 158547927) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is quinoline-2-carbaldehyde;hydrate.
Molecular Properties
| Compound Name | quinoline-2-carbaldehyde;hydrate |
| PubChem CID | 158547927 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | quinoline-2-carbaldehyde;hydrate |
| SMILES | O.O=Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H7NO.H2O/c12-7-9-6-5-8-3-1-2-4-10(8)11-9;/h1-7H;1H2 |
| InChIKey | HPIYFEIEJVDTAV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze quinoline-2-carbaldehyde;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carbaldehyde;hydrate?
The IUPAC name of quinoline-2-carbaldehyde;hydrate (CID 158547927) is quinoline-2-carbaldehyde;hydrate.
What is the SMILES notation for quinoline-2-carbaldehyde;hydrate?
The canonical SMILES for quinoline-2-carbaldehyde;hydrate is O.O=Cc1ccc2ccccc2n1.
What is the InChIKey of quinoline-2-carbaldehyde;hydrate?
The InChIKey is HPIYFEIEJVDTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO.H2O/c12-7-9-6-5-8-3-1-2-4-10(8)11-9;/h1-7H;1H2.
What are the key properties of quinoline-2-carbaldehyde;hydrate?
quinoline-2-carbaldehyde;hydrate has a molecular weight of 175.19 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carbaldehyde;hydrate is sourced from PubChem (CID 158547927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).