C18H14N2 — CID 91436844
2-(4-pyridin-2-ylbuta-1,3-dienyl)quinoline (PubChem CID 91436844) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylbuta-1,3-dienyl)quinoline.
| Compound Name | 2-(4-pyridin-2-ylbuta-1,3-dienyl)quinoline |
|---|---|
| PubChem CID | 91436844 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-(4-pyridin-2-ylbuta-1,3-dienyl)quinoline |
| SMILES | C(C=Cc1ccc2ccccc2n1)=Cc1ccccn1 |
| InChI | InChI=1S/C18H14N2/c1-4-11-18-15(7-1)12-13-17(20-18)10-3-2-8-16-9-5-6-14-19-16/h1-14H |
| InChIKey | MXNNOHDLWUPORO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|