C17H12N2O3 — CID 6445032
2-[(1E,3E)-4-(5-nitrofuran-2-yl)buta-1,3-dienyl]quinoline (PubChem CID 6445032) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(5-nitrofuran-2-yl)buta-1,3-dienyl]quinoline.
| Compound Name | 2-[(1E,3E)-4-(5-nitrofuran-2-yl)buta-1,3-dienyl]quinoline |
|---|---|
| PubChem CID | 6445032 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[(1E,3E)-4-(5-nitrofuran-2-yl)buta-1,3-dienyl]quinoline |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C=C/c2ccc3ccccc3n2)o1 |
| InChI | InChI=1S/C17H12N2O3/c20-19(21)17-12-11-15(22-17)7-3-2-6-14-10-9-13-5-1-4-8-16(13)18-14/h1-12H/b6-2+,7-3+ |
| InChIKey | NUPPLLNRGWABIA-YPCIICBESA-N |
| XLogP | 4.46 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|