C16H12N2S — CID 155776746
2-(4-pyridin-2-ylbuta-1,3-dienyl)-1,3-benzothiazole (PubChem CID 155776746) has the molecular formula C16H12N2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylbuta-1,3-dienyl)-1,3-benzothiazole.
| Compound Name | 2-(4-pyridin-2-ylbuta-1,3-dienyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 155776746 |
| Molecular Formula | C16H12N2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(4-pyridin-2-ylbuta-1,3-dienyl)-1,3-benzothiazole |
| SMILES | C(C=Cc1nc2ccccc2s1)=Cc1ccccn1 |
| InChI | InChI=1S/C16H12N2S/c1(7-13-8-5-6-12-17-13)4-11-16-18-14-9-2-3-10-15(14)19-16/h1-12H |
| InChIKey | BPZQYGSWBYOQEV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|