C17H12I2N2S — CID 163502609
4-[(1E,3E)-4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N,N-diiodoaniline (PubChem CID 163502609) has the molecular formula C17H12I2N2S and a molecular weight of 530.17 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N,N-diiodoaniline.
| Compound Name | 4-[(1E,3E)-4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N,N-diiodoaniline |
|---|---|
| PubChem CID | 163502609 |
| Molecular Formula | C17H12I2N2S |
| Molecular Weight | 530.17 g/mol |
| Exact Mass | 529.88 |
| IUPAC Name | 4-[(1E,3E)-4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N,N-diiodoaniline |
| SMILES | IN(I)c1ccc(/C=C/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H12I2N2S/c18-21(19)14-11-9-13(10-12-14)5-1-4-8-17-20-15-6-2-3-7-16(15)22-17/h1-12H/b5-1+,8-4+ |
| InChIKey | CWALLWLKGUUQTI-LZSLGQGWSA-N |
| XLogP | 6.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.17 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|