C15H10N4S — CID 71665743
2-[(E)-2-(4-azidophenyl)ethenyl]-1,3-benzothiazole (PubChem CID 71665743) has the molecular formula C15H10N4S and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[(E)-2-(4-azidophenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-azidophenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 71665743 |
| Molecular Formula | C15H10N4S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[(E)-2-(4-azidophenyl)ethenyl]-1,3-benzothiazole |
| SMILES | [N-]=[N+]=Nc1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H10N4S/c16-19-18-12-8-5-11(6-9-12)7-10-15-17-13-3-1-2-4-14(13)20-15/h1-10H/b10-7+ |
| InChIKey | QPDSAGOLRHOFPL-JXMROGBWSA-N |
| XLogP | 5.41 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|