About 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline (PubChem CID 53315247) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline.
Molecular Properties
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline |
| PubChem CID | 53315247 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline |
| SMILES | Cc1cc(/C=C/c2nc3ccccc3s2)ccc1N(C)C |
| InChI | InChI=1S/C18H18N2S/c1-13-12-14(8-10-16(13)20(2)3)9-11-18-19-15-6-4-5-7-17(15)21-18/h4-12H,1-3H3/b11-9+ |
| InChIKey | CSZQJCVSHSHBRV-PKNBQFBNSA-N |
| XLogP | 4.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline?
The IUPAC name of 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline (CID 53315247) is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline.
What is the SMILES notation for 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline?
The canonical SMILES for 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline is Cc1cc(/C=C/c2nc3ccccc3s2)ccc1N(C)C.
What is the InChIKey of 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline?
The InChIKey is CSZQJCVSHSHBRV-PKNBQFBNSA-N. The full InChI is InChI=1S/C18H18N2S/c1-13-12-14(8-10-16(13)20(2)3)9-11-18-19-15-6-4-5-7-17(15)21-18/h4-12H,1-3H3/b11-9+.
What are the key properties of 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline?
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline has a molecular weight of 294.42 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline is sourced from PubChem (CID 53315247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).