C18H18N2S — CID 53315247
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline (PubChem CID 53315247) has the molecular formula C18H18N2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline.
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 53315247 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N,2-trimethylaniline |
| SMILES | Cc1cc(/C=C/c2nc3ccccc3s2)ccc1N(C)C |
| InChI | InChI=1S/C18H18N2S/c1-13-12-14(8-10-16(13)20(2)3)9-11-18-19-15-6-4-5-7-17(15)21-18/h4-12H,1-3H3/b11-9+ |
| InChIKey | CSZQJCVSHSHBRV-PKNBQFBNSA-N |
| XLogP | 4.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|