C17H15NOS — CID 75890376
2-[2-(3-ethoxyphenyl)ethenyl]-1,3-benzothiazole (PubChem CID 75890376) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[2-(3-ethoxyphenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(3-ethoxyphenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 75890376 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[2-(3-ethoxyphenyl)ethenyl]-1,3-benzothiazole |
| SMILES | CCOc1cccc(C=Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H15NOS/c1-2-19-14-7-5-6-13(12-14)10-11-17-18-15-8-3-4-9-16(15)20-17/h3-12H,2H2,1H3 |
| InChIKey | SGNIVUBSDWURNQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |