C20H22NO3PS — CID 15738670
2-[(E)-2-[4-(diethoxyphosphorylmethyl)phenyl]ethenyl]-1,3-benzothiazole (PubChem CID 15738670) has the molecular formula C20H22NO3PS and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[(E)-2-[4-(diethoxyphosphorylmethyl)phenyl]ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-[4-(diethoxyphosphorylmethyl)phenyl]ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 15738670 |
| Molecular Formula | C20H22NO3PS |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[(E)-2-[4-(diethoxyphosphorylmethyl)phenyl]ethenyl]-1,3-benzothiazole |
| SMILES | CCOP(=O)(Cc1ccc(/C=C/c2nc3ccccc3s2)cc1)OCC |
| InChI | InChI=1S/C20H22NO3PS/c1-3-23-25(22,24-4-2)15-17-11-9-16(10-12-17)13-14-20-21-18-7-5-6-8-19(18)26-20/h5-14H,3-4,15H2,1-2H3/b14-13+ |
| InChIKey | AJDUXEHRFVYYKM-BUHFOSPRSA-N |
| XLogP | 6.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|