About CID 24828815
CID 24828815 (PubChem CID 24828815) has the molecular formula C25H30N3OS
and a molecular weight of 420.60 g/mol.
Molecular Properties
| Compound Name | CID 24828815 |
| PubChem CID | 24828815 |
| Molecular Formula | C25H30N3OS |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NCc2ccc(/C=C/c3nc4ccccc4s3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H30N3OS/c1-24(2)15-20(16-25(3,4)28(24)29)26-17-19-11-9-18(10-12-19)13-14-23-27-21-7-5-6-8-22(21)30-23/h5-14,20,26H,15-17H2,1-4H3/b14-13+ |
| InChIKey | WPDFXHQNJDFYQG-BUHFOSPRSA-N |
| XLogP | 5.92 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 24828815 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24828815?
The IUPAC name of CID 24828815 (CID 24828815) is not available.
What is the SMILES notation for CID 24828815?
The canonical SMILES for CID 24828815 is CC1(C)CC(NCc2ccc(/C=C/c3nc4ccccc4s3)cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 24828815?
The InChIKey is WPDFXHQNJDFYQG-BUHFOSPRSA-N. The full InChI is InChI=1S/C25H30N3OS/c1-24(2)15-20(16-25(3,4)28(24)29)26-17-19-11-9-18(10-12-19)13-14-23-27-21-7-5-6-8-22(21)30-23/h5-14,20,26H,15-17H2,1-4H3/b14-13+.
What are the key properties of CID 24828815?
CID 24828815 has a molecular weight of 420.60 g/mol, XLogP of 5.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24828815 is sourced from PubChem (CID 24828815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).