C25H30N3OS — CID 24828815
CID 24828815 (PubChem CID 24828815) has the molecular formula C25H30N3OS and a molecular weight of 420.60 g/mol.
| Compound Name | CID 24828815 |
|---|---|
| PubChem CID | 24828815 |
| Molecular Formula | C25H30N3OS |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NCc2ccc(/C=C/c3nc4ccccc4s3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C25H30N3OS/c1-24(2)15-20(16-25(3,4)28(24)29)26-17-19-11-9-18(10-12-19)13-14-23-27-21-7-5-6-8-22(21)30-23/h5-14,20,26H,15-17H2,1-4H3/b14-13+ |
| InChIKey | WPDFXHQNJDFYQG-BUHFOSPRSA-N |
| XLogP | 5.92 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |