C18H16N2S — CID 73097732
4-[4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N-methylaniline (PubChem CID 73097732) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N-methylaniline.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N-methylaniline |
|---|---|
| PubChem CID | 73097732 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)buta-1,3-dienyl]-N-methylaniline |
| SMILES | CNc1ccc(C=CC=Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H16N2S/c1-19-15-12-10-14(11-13-15)6-2-5-9-18-20-16-7-3-4-8-17(16)21-18/h2-13,19H,1H3 |
| InChIKey | JDLDYIJZZHQADL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|