C17H13NS — CID 20727324
2-[(E)-2-(4-ethenylphenyl)ethenyl]-1,3-benzothiazole (PubChem CID 20727324) has the molecular formula C17H13NS and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[(E)-2-(4-ethenylphenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-ethenylphenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 20727324 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[(E)-2-(4-ethenylphenyl)ethenyl]-1,3-benzothiazole |
| SMILES | C=Cc1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H13NS/c1-2-13-7-9-14(10-8-13)11-12-17-18-15-5-3-4-6-16(15)19-17/h2-12H,1H2/b12-11+ |
| InChIKey | DUKBHDQVDTWRCP-VAWYXSNFSA-N |
| XLogP | 5.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |