C19H22N2S — CID 90760249
4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethylaniline;ethane (PubChem CID 90760249) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethylaniline;ethane.
| Compound Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethylaniline;ethane |
|---|---|
| PubChem CID | 90760249 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-N,N-dimethylaniline;ethane |
| SMILES | CC.CN(C)c1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H16N2S.C2H6/c1-19(2)14-10-7-13(8-11-14)9-12-17-18-15-5-3-4-6-16(15)20-17;1-2/h3-12H,1-2H3;1-2H3/b12-9+; |
| InChIKey | DGNBCHAXFBOFSE-NBYYMMLRSA-N |
| XLogP | 5.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|