C22H21N3S — CID 25136669
4-[5-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-1-methylpyrrol-2-yl]-N,N-dimethylaniline (PubChem CID 25136669) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-[5-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-1-methylpyrrol-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-1-methylpyrrol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 25136669 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[5-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]-1-methylpyrrol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2ccc(/C=C/c3nc4ccccc4s3)n2C)cc1 |
| InChI | InChI=1S/C22H21N3S/c1-24(2)17-10-8-16(9-11-17)20-14-12-18(25(20)3)13-15-22-23-19-6-4-5-7-21(19)26-22/h4-15H,1-3H3/b15-13+ |
| InChIKey | FNZPNCWWLXUIOB-FYWRMAATSA-N |
| XLogP | 5.54 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|