C42H34N4O2S2Zn — CID 56654205
zinc bis(2-(1,3-benzothiazol-2-yl)-4-[4-(dimethylamino)phenyl]phenolate) (PubChem CID 56654205) has the molecular formula C42H34N4O2S2Zn and a molecular weight of 756.28 g/mol. Its IUPAC name is zinc bis(2-(1,3-benzothiazol-2-yl)-4-[4-(dimethylamino)phenyl]phenolate).
| Compound Name | zinc bis(2-(1,3-benzothiazol-2-yl)-4-[4-(dimethylamino)phenyl]phenolate) |
|---|---|
| PubChem CID | 56654205 |
| Molecular Formula | C42H34N4O2S2Zn |
| Molecular Weight | 756.28 g/mol |
| Exact Mass | 754.14 |
| IUPAC Name | zinc bis(2-(1,3-benzothiazol-2-yl)-4-[4-(dimethylamino)phenyl]phenolate) |
| SMILES | CN(C)c1ccc(-c2ccc([O-])c(-c3nc4ccccc4s3)c2)cc1.CN(C)c1ccc(-c2ccc([O-])c(-c3nc4ccccc4s3)c2)cc1.[Zn+2] |
| InChI | InChI=1S/2C21H18N2OS.Zn/c2*1-23(2)16-10-7-14(8-11-16)15-9-12-19(24)17(13-15)21-22-18-5-3-4-6-20(18)25-21;/h2*3-13,24H,1-2H3;/q;;+2/p-2 |
| InChIKey | AJMRZSORXFKOMQ-UHFFFAOYSA-L |
| XLogP | 9.54 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.28 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|