C16H15FN2S — CID 139235313
4-(1,3-benzothiazol-2-yl)-N-(2-fluoroethyl)-N-methylaniline (PubChem CID 139235313) has the molecular formula C16H15FN2S and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(2-fluoroethyl)-N-methylaniline.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(2-fluoroethyl)-N-methylaniline |
|---|---|
| PubChem CID | 139235313 |
| Molecular Formula | C16H15FN2S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(2-fluoroethyl)-N-methylaniline |
| SMILES | CN(CCF)c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H15FN2S/c1-19(11-10-17)13-8-6-12(7-9-13)16-18-14-4-2-3-5-15(14)20-16/h2-9H,10-11H2,1H3 |
| InChIKey | ISPZLLIXXYWIDD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|